C19H16N4OS2 — CID 24521045
1-(3-methyl-1-benzothiophen-2-yl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 24521045) has the molecular formula C19H16N4OS2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 1-(3-methyl-1-benzothiophen-2-yl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-(3-methyl-1-benzothiophen-2-yl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 24521045 |
| Molecular Formula | C19H16N4OS2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-(3-methyl-1-benzothiophen-2-yl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | Cc1ccccc1-n1nnnc1SCC(=O)c1sc2ccccc2c1C |
| InChI | InChI=1S/C19H16N4OS2/c1-12-7-3-5-9-15(12)23-19(20-21-22-23)25-11-16(24)18-13(2)14-8-4-6-10-17(14)26-18/h3-10H,11H2,1-2H3 |
| InChIKey | NXPWVMLWXOLAGS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |