C20H22N6O2S — CID 7762487
N,N-diethyl-4-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzamide (PubChem CID 7762487) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 7762487 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N,N-diethyl-4-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CSc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N6O2S/c1-3-25(4-2)19(28)15-10-12-16(13-11-15)21-18(27)14-29-20-22-23-24-26(20)17-8-6-5-7-9-17/h5-13H,3-4,14H2,1-2H3,(H,21,27) |
| InChIKey | GQVBCYMTOKBMBM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |