C17H14FN5O4S — CID 162373388
4-[5-[2-(4-carbamoylphenyl)-2-hydroxyethyl]sulfanyltetrazol-1-yl]-2-fluorobenzoic acid (PubChem CID 162373388) has the molecular formula C17H14FN5O4S and a molecular weight of 403.40 g/mol. Its IUPAC name is 4-[5-[2-(4-carbamoylphenyl)-2-hydroxyethyl]sulfanyltetrazol-1-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[5-[2-(4-carbamoylphenyl)-2-hydroxyethyl]sulfanyltetrazol-1-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 162373388 |
| Molecular Formula | C17H14FN5O4S |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 4-[5-[2-(4-carbamoylphenyl)-2-hydroxyethyl]sulfanyltetrazol-1-yl]-2-fluorobenzoic acid |
| SMILES | NC(=O)c1ccc(C(O)CSc2nnnn2-c2ccc(C(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C17H14FN5O4S/c18-13-7-11(5-6-12(13)16(26)27)23-17(20-21-22-23)28-8-14(24)9-1-3-10(4-2-9)15(19)25/h1-7,14,24H,8H2,(H2,19,25)(H,26,27) |
| InChIKey | VRODCFKVRBUWQZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |