C9H5ClFN4O2S- — CID 7473069
2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 7473069) has the molecular formula C9H5ClFN4O2S- and a molecular weight of 287.68 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 7473069 |
| Molecular Formula | C9H5ClFN4O2S- |
| Molecular Weight | 287.68 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | O=C([O-])CSc1nnnn1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H6ClFN4O2S/c10-6-3-5(1-2-7(6)11)15-9(12-13-14-15)18-4-8(16)17/h1-3H,4H2,(H,16,17)/p-1 |
| InChIKey | MCRRWHROXYLHST-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.68 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |