C15H9ClFN4O2S- — CID 4520504
2-chloro-5-[5-[(2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzoate (PubChem CID 4520504) has the molecular formula C15H9ClFN4O2S- and a molecular weight of 363.78 g/mol. Its IUPAC name is 2-chloro-5-[5-[(2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzoate.
| Compound Name | 2-chloro-5-[5-[(2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 4520504 |
| Molecular Formula | C15H9ClFN4O2S- |
| Molecular Weight | 363.78 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 2-chloro-5-[5-[(2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzoate |
| SMILES | O=C([O-])c1cc(-n2nnnc2SCc2ccccc2F)ccc1Cl |
| InChI | InChI=1S/C15H10ClFN4O2S/c16-12-6-5-10(7-11(12)14(22)23)21-15(18-19-20-21)24-8-9-3-1-2-4-13(9)17/h1-7H,8H2,(H,22,23)/p-1 |
| InChIKey | WTEBZLOIWUPKDW-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.78 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |