C15H12ClFN4S — CID 2615946
5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1-(4-methylphenyl)tetrazole (PubChem CID 2615946) has the molecular formula C15H12ClFN4S and a molecular weight of 334.81 g/mol. Its IUPAC name is 5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1-(4-methylphenyl)tetrazole.
| Compound Name | 5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1-(4-methylphenyl)tetrazole |
|---|---|
| PubChem CID | 2615946 |
| Molecular Formula | C15H12ClFN4S |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1-(4-methylphenyl)tetrazole |
| SMILES | Cc1ccc(-n2nnnc2SCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C15H12ClFN4S/c1-10-5-7-11(8-6-10)21-15(18-19-20-21)22-9-12-13(16)3-2-4-14(12)17/h2-8H,9H2,1H3 |
| InChIKey | DVLMCJCBGVSPNA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |