C17H16ClFN4S — CID 7561389
5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1-(4-propan-2-ylphenyl)tetrazole (PubChem CID 7561389) has the molecular formula C17H16ClFN4S and a molecular weight of 362.86 g/mol. Its IUPAC name is 5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1-(4-propan-2-ylphenyl)tetrazole.
| Compound Name | 5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1-(4-propan-2-ylphenyl)tetrazole |
|---|---|
| PubChem CID | 7561389 |
| Molecular Formula | C17H16ClFN4S |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1-(4-propan-2-ylphenyl)tetrazole |
| SMILES | CC(C)c1ccc(-n2nnnc2SCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClFN4S/c1-11(2)12-6-8-13(9-7-12)23-17(20-21-22-23)24-10-14-15(18)4-3-5-16(14)19/h3-9,11H,10H2,1-2H3 |
| InChIKey | ULCOXHYSTZDEGF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |