C13H15ClFN5OS — CID 598507
N-tert-butyl-2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 598507) has the molecular formula C13H15ClFN5OS and a molecular weight of 343.82 g/mol. Its IUPAC name is N-tert-butyl-2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-tert-butyl-2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 598507 |
| Molecular Formula | C13H15ClFN5OS |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-tert-butyl-2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CC(C)(C)NC(=O)CSc1nnnn1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClFN5OS/c1-13(2,3)16-11(21)7-22-12-17-18-19-20(12)8-4-5-10(15)9(14)6-8/h4-6H,7H2,1-3H3,(H,16,21) |
| InChIKey | RZMZRCGDPAQDEI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |