C20H19F3N6O2S — CID 24500505
N-(4-pyrrolidin-1-ylphenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylacetamide (PubChem CID 24500505) has the molecular formula C20H19F3N6O2S and a molecular weight of 464.47 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylphenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(4-pyrrolidin-1-ylphenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 24500505 |
| Molecular Formula | C20H19F3N6O2S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N-(4-pyrrolidin-1-ylphenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(OC(F)(F)F)cc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H19F3N6O2S/c21-20(22,23)31-17-9-7-16(8-10-17)29-19(25-26-27-29)32-13-18(30)24-14-3-5-15(6-4-14)28-11-1-2-12-28/h3-10H,1-2,11-13H2,(H,24,30) |
| InChIKey | PUSBAWYIUHGNSD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|