C8H5F3N4OS — CID 2732840
1-[4-(trifluoromethoxy)phenyl]-2H-tetrazole-5-thione (PubChem CID 2732840) has the molecular formula C8H5F3N4OS and a molecular weight of 262.22 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]-2H-tetrazole-5-thione.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 2732840 |
| Molecular Formula | C8H5F3N4OS |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]-2H-tetrazole-5-thione |
| SMILES | FC(F)(F)Oc1ccc(-n2[nH]nnc2=S)cc1 |
| InChI | InChI=1S/C8H5F3N4OS/c9-8(10,11)16-6-3-1-5(2-4-6)15-7(17)12-13-14-15/h1-4H,(H,12,14,17) |
| InChIKey | IGNYLBCSNHGHSU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|