About 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one
3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one (PubChem CID 135587724) has the molecular formula C13H13N5O3S
and a molecular weight of 319.35 g/mol. Its IUPAC name is 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one.
Molecular Properties
| Compound Name | 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one |
| PubChem CID | 135587724 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one |
| SMILES | CC1(C)C(O)=C(O)C(=O)N1c1ccc(-n2[nH]nnc2=S)cc1 |
| InChI | InChI=1S/C13H13N5O3S/c1-13(2)10(20)9(19)11(21)17(13)7-3-5-8(6-4-7)18-12(22)14-15-16-18/h3-6,19-20H,1-2H3,(H,14,16,22) |
| InChIKey | PQPGQGDDDXTRDL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one?
The IUPAC name of 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one (CID 135587724) is 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one.
What is the SMILES notation for 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one?
The canonical SMILES for 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one is CC1(C)C(O)=C(O)C(=O)N1c1ccc(-n2[nH]nnc2=S)cc1.
What is the InChIKey of 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one?
The InChIKey is PQPGQGDDDXTRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O3S/c1-13(2)10(20)9(19)11(21)17(13)7-3-5-8(6-4-7)18-12(22)14-15-16-18/h3-6,19-20H,1-2H3,(H,14,16,22).
What are the key properties of 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one?
3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one has a molecular weight of 319.35 g/mol, XLogP of 1.78, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one is sourced from PubChem (CID 135587724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).