C13H13N5O3S — CID 135587724
3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one (PubChem CID 135587724) has the molecular formula C13H13N5O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one.
| Compound Name | 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one |
|---|---|
| PubChem CID | 135587724 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3,4-dihydroxy-5,5-dimethyl-1-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]pyrrol-2-one |
| SMILES | CC1(C)C(O)=C(O)C(=O)N1c1ccc(-n2[nH]nnc2=S)cc1 |
| InChI | InChI=1S/C13H13N5O3S/c1-13(2)10(20)9(19)11(21)17(13)7-3-5-8(6-4-7)18-12(22)14-15-16-18/h3-6,19-20H,1-2H3,(H,14,16,22) |
| InChIKey | PQPGQGDDDXTRDL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|