C9H5ClF3N3O — CID 63384165
3-chloro-4-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole (PubChem CID 63384165) has the molecular formula C9H5ClF3N3O and a molecular weight of 263.61 g/mol. Its IUPAC name is 3-chloro-4-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole.
| Compound Name | 3-chloro-4-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 63384165 |
| Molecular Formula | C9H5ClF3N3O |
| Molecular Weight | 263.61 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 3-chloro-4-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole |
| SMILES | FC(F)(F)Oc1ccc(-n2cnnc2Cl)cc1 |
| InChI | InChI=1S/C9H5ClF3N3O/c10-8-15-14-5-16(8)6-1-3-7(4-2-6)17-9(11,12)13/h1-5H |
| InChIKey | NBKKHEOODXORFN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |