C17H16F3IN6O — CID 111066023
2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111066023) has the molecular formula C17H16F3IN6O and a molecular weight of 504.25 g/mol. Its IUPAC name is 2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111066023 |
| Molecular Formula | C17H16F3IN6O |
| Molecular Weight | 504.25 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1nncn1-c1ccccc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3N6O.HI/c18-17(19,20)27-14-8-6-12(7-9-14)24-16(21)22-10-15-25-23-11-26(15)13-4-2-1-3-5-13;/h1-9,11H,10H2,(H3,21,22,24);1H |
| InChIKey | WEQSMVWSJJXDQJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|