C18H15F3N4O2 — CID 111078091
2-[(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111078091) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-[(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111078091 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-[(5-phenyl-1,2-oxazol-3-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\Cc1cc(-c2ccccc2)on1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N4O2/c19-18(20,21)26-15-8-6-13(7-9-15)24-17(22)23-11-14-10-16(27-25-14)12-4-2-1-3-5-12/h1-10H,11H2,(H3,22,23,24) |
| InChIKey | VJFKZVDQGXWMHR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|