C20H21IN4O3 — CID 111078128
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111078128) has the molecular formula C20H21IN4O3 and a molecular weight of 492.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111078128 |
| Molecular Formula | C20H21IN4O3 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cc(-c2ccccc2)on1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H20N4O3.HI/c21-20(23-15-7-8-17-19(11-15)26-10-4-9-25-17)22-13-16-12-18(27-24-16)14-5-2-1-3-6-14;/h1-3,5-8,11-12H,4,9-10,13H2,(H3,21,22,23);1H |
| InChIKey | GFXIGXUCFPAXAX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|