C15H19F3IN5O2 — CID 110061835
2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 110061835) has the molecular formula C15H19F3IN5O2 and a molecular weight of 485.25 g/mol. Its IUPAC name is 2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110061835 |
| Molecular Formula | C15H19F3IN5O2 |
| Molecular Weight | 485.25 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | COc1c(C/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)c(C)nn1C.I |
| InChI | InChI=1S/C15H18F3N5O2.HI/c1-9-12(13(24-3)23(2)22-9)8-20-14(19)21-10-4-6-11(7-5-10)25-15(16,17)18;/h4-7H,8H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | OYHPXJBFMONTFK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|