C18H17F3N6O2 — CID 111101571
2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111101571) has the molecular formula C18H17F3N6O2 and a molecular weight of 406.37 g/mol. Its IUPAC name is 2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111101571 |
| Molecular Formula | C18H17F3N6O2 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | COc1ccc(-c2n[nH]c(C/N=C(\N)Nc3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H17F3N6O2/c1-28-13-6-2-11(3-7-13)16-25-15(26-27-16)10-23-17(22)24-12-4-8-14(9-5-12)29-18(19,20)21/h2-9H,10H2,1H3,(H3,22,23,24)(H,25,26,27) |
| InChIKey | CIWJRQPLNOBQEN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|