C20H23IN6O3 — CID 119121624
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide (PubChem CID 119121624) has the molecular formula C20H23IN6O3 and a molecular weight of 522.35 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119121624 |
| Molecular Formula | C20H23IN6O3 |
| Molecular Weight | 522.35 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(-c2n[nH]c(C/N=C(\N)Nc3ccc4c(c3)OCCCO4)n2)cc1.I |
| InChI | InChI=1S/C20H22N6O3.HI/c1-27-15-6-3-13(4-7-15)19-24-18(25-26-19)12-22-20(21)23-14-5-8-16-17(11-14)29-10-2-9-28-16;/h3-8,11H,2,9-10,12H2,1H3,(H3,21,22,23)(H,24,25,26);1H |
| InChIKey | CTFRSFCISFRCQM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|