C20H22N6O2 — CID 111600284
1-(3,4-dihydro-2H-chromen-4-yl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine (PubChem CID 111600284) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111600284 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine |
| SMILES | COc1ccc(-c2n[nH]c(C/N=C(\N)NC3CCOc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C20H22N6O2/c1-27-14-8-6-13(7-9-14)19-24-18(25-26-19)12-22-20(21)23-16-10-11-28-17-5-3-2-4-15(16)17/h2-9,16H,10-12H2,1H3,(H3,21,22,23)(H,24,25,26) |
| InChIKey | KAHQKEBAXWMMRT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|