C17H19FIN3O — CID 111597519
1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 111597519) has the molecular formula C17H19FIN3O and a molecular weight of 427.26 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111597519 |
| Molecular Formula | C17H19FIN3O |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(F)cc1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C17H18FN3O.HI/c18-13-7-5-12(6-8-13)11-20-17(19)21-15-9-10-22-16-4-2-1-3-14(15)16;/h1-8,15H,9-11H2,(H3,19,20,21);1H |
| InChIKey | BDVCFPQDBSLNBE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|