C19H21F3IN3O2 — CID 111598073
1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111598073) has the molecular formula C19H21F3IN3O2 and a molecular weight of 507.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598073 |
| Molecular Formula | C19H21F3IN3O2 |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C19H20F3N3O2.HI/c20-19(21,22)12-27-14-7-5-13(6-8-14)11-24-18(23)25-16-9-10-26-17-4-2-1-3-15(16)17;/h1-8,16H,9-12H2,(H3,23,24,25);1H |
| InChIKey | WNAHFUBKIKCVHS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|