C18H19F3N4O2 — CID 111598450
1-(3,4-dihydro-2H-chromen-4-yl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111598450) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111598450 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(OCC(F)(F)F)nc1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H19F3N4O2/c19-18(20,21)11-27-16-6-5-12(9-23-16)10-24-17(22)25-14-7-8-26-15-4-2-1-3-13(14)15/h1-6,9,14H,7-8,10-11H2,(H3,22,24,25) |
| InChIKey | AOWRNMAKIVSANQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|