C16H16F3N5O — CID 122099166
1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine (PubChem CID 122099166) has the molecular formula C16H16F3N5O and a molecular weight of 351.33 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 122099166 |
| Molecular Formula | C16H16F3N5O |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine |
| SMILES | N/C(=N\Cc1nccc(C(F)(F)F)n1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H16F3N5O/c17-16(18,19)13-5-7-21-14(24-13)9-22-15(20)23-11-6-8-25-12-4-2-1-3-10(11)12/h1-5,7,11H,6,8-9H2,(H3,20,22,23) |
| InChIKey | MUOKHIYKVHWWQW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|