C18H16F3NO3 — CID 39096701
N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 39096701) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 39096701 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(N[C@@H]1CCOc2ccccc21)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3NO3/c19-18(20,21)11-25-13-7-5-12(6-8-13)17(23)22-15-9-10-24-16-4-2-1-3-14(15)16/h1-8,15H,9-11H2,(H,22,23)/t15-/m1/s1 |
| InChIKey | BXOZQQUDYXWIPC-OAHLLOKOSA-N |
| XLogP | 3.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |