C18H20F2IN3O — CID 111600914
2-[2-(2,5-difluorophenyl)ethyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine;hydroiodide (PubChem CID 111600914) has the molecular formula C18H20F2IN3O and a molecular weight of 459.28 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)ethyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-difluorophenyl)ethyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111600914 |
| Molecular Formula | C18H20F2IN3O |
| Molecular Weight | 459.28 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)ethyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1cc(F)ccc1F)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H19F2N3O.HI/c19-13-5-6-15(20)12(11-13)7-9-22-18(21)23-16-8-10-24-17-4-2-1-3-14(16)17;/h1-6,11,16H,7-10H2,(H3,21,22,23);1H |
| InChIKey | AEHRQCHXZQCIOG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|