C18H17FN4O — CID 111803254
2-[(4-cyano-2-fluorophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine (PubChem CID 111803254) has the molecular formula C18H17FN4O and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[(4-cyano-2-fluorophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine.
| Compound Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine |
|---|---|
| PubChem CID | 111803254 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[(4-cyano-2-fluorophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine |
| SMILES | N#Cc1ccc(C/N=C(\N)NC2CCOc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C18H17FN4O/c19-15-9-12(10-20)5-6-13(15)11-22-18(21)23-16-7-8-24-17-4-2-1-3-14(16)17/h1-6,9,16H,7-8,11H2,(H3,21,22,23) |
| InChIKey | LGQKJHZLPMVQLL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|