C15H18N4O2 — CID 119140950
1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 119140950) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119140950 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | Cc1cc(C/N=C(\N)NC2CCOc3ccccc32)on1 |
| InChI | InChI=1S/C15H18N4O2/c1-10-8-11(21-19-10)9-17-15(16)18-13-6-7-20-14-5-3-2-4-12(13)14/h2-5,8,13H,6-7,9H2,1H3,(H3,16,17,18) |
| InChIKey | MXSSISSGOVNYMN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|