C12H21IN4O — CID 119120615
1-cyclohexyl-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 119120615) has the molecular formula C12H21IN4O and a molecular weight of 364.23 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119120615 |
| Molecular Formula | C12H21IN4O |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-cyclohexyl-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C/N=C(\N)NC2CCCCC2)on1.I |
| InChI | InChI=1S/C12H20N4O.HI/c1-9-7-11(17-16-9)8-14-12(13)15-10-5-3-2-4-6-10;/h7,10H,2-6,8H2,1H3,(H3,13,14,15);1H |
| InChIKey | GTDPXQGBTQHDIR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|