C14H23N5 — CID 120913740
1-cyclohexyl-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine (PubChem CID 120913740) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 120913740 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 1-cyclohexyl-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine |
| SMILES | Cc1cc(C/N=C(\N)NC2CCCCC2)nc(C)n1 |
| InChI | InChI=1S/C14H23N5/c1-10-8-13(18-11(2)17-10)9-16-14(15)19-12-6-4-3-5-7-12/h8,12H,3-7,9H2,1-2H3,(H3,15,16,19) |
| InChIKey | UDWYSMSOKNOKCU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|