C11H19N5 — CID 62369717
1-cyclopentyl-2-[(5-methyl-1H-pyrazol-4-yl)methyl]guanidine (PubChem CID 62369717) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(5-methyl-1H-pyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[(5-methyl-1H-pyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 62369717 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-cyclopentyl-2-[(5-methyl-1H-pyrazol-4-yl)methyl]guanidine |
| SMILES | Cc1[nH]ncc1C/N=C(\N)NC1CCCC1 |
| InChI | InChI=1S/C11H19N5/c1-8-9(7-14-16-8)6-13-11(12)15-10-4-2-3-5-10/h7,10H,2-6H2,1H3,(H,14,16)(H3,12,13,15) |
| InChIKey | BCZCWXCZDIUNGP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|