C18H24IN5 — CID 120913703
2-[(2,6-dimethylpyrimidin-4-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 120913703) has the molecular formula C18H24IN5 and a molecular weight of 437.33 g/mol. Its IUPAC name is 2-[(2,6-dimethylpyrimidin-4-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[(2,6-dimethylpyrimidin-4-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120913703 |
| Molecular Formula | C18H24IN5 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-[(2,6-dimethylpyrimidin-4-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | Cc1cc(C/N=C(\N)Nc2cccc3c2CCCC3)nc(C)n1.I |
| InChI | InChI=1S/C18H23N5.HI/c1-12-10-15(22-13(2)21-12)11-20-18(19)23-17-9-5-7-14-6-3-4-8-16(14)17;/h5,7,9-10H,3-4,6,8,11H2,1-2H3,(H3,19,20,23);1H |
| InChIKey | LRUFQNKNLFCKQL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|