C16H21N5O — CID 120913688
2-[(2,6-dimethylpyrimidin-4-yl)methyl]-1-[2-(methoxymethyl)phenyl]guanidine (PubChem CID 120913688) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-[(2,6-dimethylpyrimidin-4-yl)methyl]-1-[2-(methoxymethyl)phenyl]guanidine.
| Compound Name | 2-[(2,6-dimethylpyrimidin-4-yl)methyl]-1-[2-(methoxymethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 120913688 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[(2,6-dimethylpyrimidin-4-yl)methyl]-1-[2-(methoxymethyl)phenyl]guanidine |
| SMILES | COCc1ccccc1N/C(N)=N/Cc1cc(C)nc(C)n1 |
| InChI | InChI=1S/C16H21N5O/c1-11-8-14(20-12(2)19-11)9-18-16(17)21-15-7-5-4-6-13(15)10-22-3/h4-8H,9-10H2,1-3H3,(H3,17,18,21) |
| InChIKey | FCMSTBQWWZQJIQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|