C21H23IN4 — CID 111720826
2-(isoquinolin-1-ylmethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111720826) has the molecular formula C21H23IN4 and a molecular weight of 458.35 g/mol. Its IUPAC name is 2-(isoquinolin-1-ylmethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-(isoquinolin-1-ylmethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111720826 |
| Molecular Formula | C21H23IN4 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 2-(isoquinolin-1-ylmethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1nccc2ccccc12)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C21H22N4.HI/c22-21(25-19-11-5-8-15-6-1-3-9-17(15)19)24-14-20-18-10-4-2-7-16(18)12-13-23-20;/h2,4-5,7-8,10-13H,1,3,6,9,14H2,(H3,22,24,25);1H |
| InChIKey | ZQQRMGLQAUJZDD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|