C18H24IN5 — CID 119142274
2-[2-(pyridin-2-ylamino)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 119142274) has the molecular formula C18H24IN5 and a molecular weight of 437.33 g/mol. Its IUPAC name is 2-[2-(pyridin-2-ylamino)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(pyridin-2-ylamino)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119142274 |
| Molecular Formula | C18H24IN5 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-[2-(pyridin-2-ylamino)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCNc1ccccn1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C18H23N5.HI/c19-18(22-13-12-21-17-10-3-4-11-20-17)23-16-9-5-7-14-6-1-2-8-15(14)16;/h3-5,7,9-11H,1-2,6,8,12-13H2,(H,20,21)(H3,19,22,23);1H |
| InChIKey | CHBYUNZNDROPQE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|