C19H21N7 — CID 122098078
2-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 122098078) has the molecular formula C19H21N7 and a molecular weight of 347.43 g/mol. Its IUPAC name is 2-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 122098078 |
| Molecular Formula | C19H21N7 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | N/C(=N\Cc1nc(-c2ccccn2)n[nH]1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C19H21N7/c20-19(23-15-10-5-7-13-6-1-2-8-14(13)15)22-12-17-24-18(26-25-17)16-9-3-4-11-21-16/h3-5,7,9-11H,1-2,6,8,12H2,(H3,20,22,23)(H,24,25,26) |
| InChIKey | XWKXNXTZYKAKJL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|