C22H26IN5 — CID 111720832
2-[2-(4-pyrazol-1-ylphenyl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111720832) has the molecular formula C22H26IN5 and a molecular weight of 487.39 g/mol. Its IUPAC name is 2-[2-(4-pyrazol-1-ylphenyl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-pyrazol-1-ylphenyl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111720832 |
| Molecular Formula | C22H26IN5 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-[2-(4-pyrazol-1-ylphenyl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1ccc(-n2cccn2)cc1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H25N5.HI/c23-22(26-21-8-3-6-18-5-1-2-7-20(18)21)24-15-13-17-9-11-19(12-10-17)27-16-4-14-25-27;/h3-4,6,8-12,14,16H,1-2,5,7,13,15H2,(H3,23,24,26);1H |
| InChIKey | FLSWPZHFKRCBKN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|