C22H25N5 — CID 111720841
2-[2-(1-phenylpyrazol-4-yl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 111720841) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-[2-(1-phenylpyrazol-4-yl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-[2-(1-phenylpyrazol-4-yl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 111720841 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-[2-(1-phenylpyrazol-4-yl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | N/C(=N\CCc1cnn(-c2ccccc2)c1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H25N5/c23-22(26-21-12-6-8-18-7-4-5-11-20(18)21)24-14-13-17-15-25-27(16-17)19-9-2-1-3-10-19/h1-3,6,8-10,12,15-16H,4-5,7,11,13-14H2,(H3,23,24,26) |
| InChIKey | LCWDCYJZGORBCK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|