C17H24IN5 — CID 119142370
2-[2-(2-methylimidazol-1-yl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 119142370) has the molecular formula C17H24IN5 and a molecular weight of 425.32 g/mol. Its IUPAC name is 2-[2-(2-methylimidazol-1-yl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(2-methylimidazol-1-yl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119142370 |
| Molecular Formula | C17H24IN5 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-[2-(2-methylimidazol-1-yl)ethyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | Cc1nccn1CC/N=C(\N)Nc1cccc2c1CCCC2.I |
| InChI | InChI=1S/C17H23N5.HI/c1-13-19-9-11-22(13)12-10-20-17(18)21-16-8-4-6-14-5-2-3-7-15(14)16;/h4,6,8-9,11H,2-3,5,7,10,12H2,1H3,(H3,18,20,21);1H |
| InChIKey | MDPKYKWEHJCDMA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|