C17H21F3IN5 — CID 119142380
1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 119142380) has the molecular formula C17H21F3IN5 and a molecular weight of 479.29 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119142380 |
| Molecular Formula | C17H21F3IN5 |
| Molecular Weight | 479.29 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1nccn1CC(F)(F)F)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C17H20F3N5.HI/c18-17(19,20)11-25-9-8-22-15(25)10-23-16(21)24-14-7-3-5-12-4-1-2-6-13(12)14;/h3,5,7-9H,1-2,4,6,10-11H2,(H3,21,23,24);1H |
| InChIKey | JMHRQCFRUKKSAI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|