C12H19F3IN5 — CID 119121482
1-cyclopentyl-2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 119121482) has the molecular formula C12H19F3IN5 and a molecular weight of 417.22 g/mol. Its IUPAC name is 1-cyclopentyl-2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119121482 |
| Molecular Formula | C12H19F3IN5 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 1-cyclopentyl-2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1nccn1CC(F)(F)F)NC1CCCC1 |
| InChI | InChI=1S/C12H18F3N5.HI/c13-12(14,15)8-20-6-5-17-10(20)7-18-11(16)19-9-3-1-2-4-9;/h5-6,9H,1-4,7-8H2,(H3,16,18,19);1H |
| InChIKey | LRVDNVPZCDLQQP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|