C11H21IN6 — CID 120762688
2-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-1-cyclopropylguanidine;hydroiodide (PubChem CID 120762688) has the molecular formula C11H21IN6 and a molecular weight of 364.24 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-1-cyclopropylguanidine;hydroiodide.
| Compound Name | 2-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-1-cyclopropylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120762688 |
| Molecular Formula | C11H21IN6 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-1-cyclopropylguanidine;hydroiodide |
| SMILES | CC(C)(C)n1ncnc1C/N=C(\N)NC1CC1.I |
| InChI | InChI=1S/C11H20N6.HI/c1-11(2,3)17-9(14-7-15-17)6-13-10(12)16-8-4-5-8;/h7-8H,4-6H2,1-3H3,(H3,12,13,16);1H |
| InChIKey | UGQRNACAWFDSIJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|