C11H17IN4O2S — CID 120603117
1-cyclopropyl-2-[(3-methylsulfonyl-2-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 120603117) has the molecular formula C11H17IN4O2S and a molecular weight of 396.25 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(3-methylsulfonyl-2-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[(3-methylsulfonyl-2-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120603117 |
| Molecular Formula | C11H17IN4O2S |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 1-cyclopropyl-2-[(3-methylsulfonyl-2-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CS(=O)(=O)c1cccnc1C/N=C(\N)NC1CC1.I |
| InChI | InChI=1S/C11H16N4O2S.HI/c1-18(16,17)10-3-2-6-13-9(10)7-14-11(12)15-8-4-5-8;/h2-3,6,8H,4-5,7H2,1H3,(H3,12,14,15);1H |
| InChIKey | DEWYJDRZFGSZKV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|