C13H20N4O2S — CID 120603078
1-(cyclobutylmethyl)-2-[(3-methylsulfonyl-2-pyridinyl)methyl]guanidine (PubChem CID 120603078) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[(3-methylsulfonyl-2-pyridinyl)methyl]guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-[(3-methylsulfonyl-2-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 120603078 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[(3-methylsulfonyl-2-pyridinyl)methyl]guanidine |
| SMILES | CS(=O)(=O)c1cccnc1C/N=C(\N)NCC1CCC1 |
| InChI | InChI=1S/C13H20N4O2S/c1-20(18,19)12-6-3-7-15-11(12)9-17-13(14)16-8-10-4-2-5-10/h3,6-7,10H,2,4-5,8-9H2,1H3,(H3,14,16,17) |
| InChIKey | XTGBMQPMZIZSKK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|