C13H17IN6 — CID 119118530
1-cyclopropyl-2-[(2-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 119118530) has the molecular formula C13H17IN6 and a molecular weight of 384.23 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(2-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[(2-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119118530 |
| Molecular Formula | C13H17IN6 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 1-cyclopropyl-2-[(2-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccnc1-n1ccnc1)NC1CC1 |
| InChI | InChI=1S/C13H16N6.HI/c14-13(18-11-3-4-11)17-8-10-2-1-5-16-12(10)19-7-6-15-9-19;/h1-2,5-7,9,11H,3-4,8H2,(H3,14,17,18);1H |
| InChIKey | UIXPCVHEPUVVKI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|