C16H25IN6 — CID 119116062
1-tert-butyl-3-ethyl-2-[(2-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 119116062) has the molecular formula C16H25IN6 and a molecular weight of 428.32 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-2-[(2-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-ethyl-2-[(2-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119116062 |
| Molecular Formula | C16H25IN6 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-tert-butyl-3-ethyl-2-[(2-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1-n1ccnc1)NC(C)(C)C.I |
| InChI | InChI=1S/C16H24N6.HI/c1-5-18-15(21-16(2,3)4)20-11-13-7-6-8-19-14(13)22-10-9-17-12-22;/h6-10,12H,5,11H2,1-4H3,(H2,18,20,21);1H |
| InChIKey | OUCHDJYBQXJFRL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|