C18H27ClIN7 — CID 120762630
N'-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-4-(4-chlorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 120762630) has the molecular formula C18H27ClIN7 and a molecular weight of 503.82 g/mol. Its IUPAC name is N'-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-4-(4-chlorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-4-(4-chlorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120762630 |
| Molecular Formula | C18H27ClIN7 |
| Molecular Weight | 503.82 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | N'-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-4-(4-chlorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CC(C)(C)n1ncnc1C/N=C(\N)N1CCN(c2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C18H26ClN7.HI/c1-18(2,3)26-16(22-13-23-26)12-21-17(20)25-10-8-24(9-11-25)15-6-4-14(19)5-7-15;/h4-7,13H,8-12H2,1-3H3,(H2,20,21);1H |
| InChIKey | DVPAUJWSOVDHNK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|