C19H25ClIN5O2S — CID 111046455
4-(4-chlorophenyl)-N'-[[4-(methylsulfamoyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111046455) has the molecular formula C19H25ClIN5O2S and a molecular weight of 549.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[[4-(methylsulfamoyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[[4-(methylsulfamoyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111046455 |
| Molecular Formula | C19H25ClIN5O2S |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[[4-(methylsulfamoyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CNS(=O)(=O)c1ccc(C/N=C(\N)N2CCN(c3ccc(Cl)cc3)CC2)cc1.I |
| InChI | InChI=1S/C19H24ClN5O2S.HI/c1-22-28(26,27)18-8-2-15(3-9-18)14-23-19(21)25-12-10-24(11-13-25)17-6-4-16(20)5-7-17;/h2-9,22H,10-14H2,1H3,(H2,21,23);1H |
| InChIKey | YQYAPPLQXHLEMS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|