C21H27ClN6 — CID 111048884
4-(4-chlorophenyl)-N'-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 111048884) has the molecular formula C21H27ClN6 and a molecular weight of 398.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111048884 |
| Molecular Formula | C21H27ClN6 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(N2CCCC2)nc1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H27ClN6/c22-18-4-6-19(7-5-18)26-11-13-28(14-12-26)21(23)25-16-17-3-8-20(24-15-17)27-9-1-2-10-27/h3-8,15H,1-2,9-14,16H2,(H2,23,25) |
| InChIKey | NLIDUZAQXYENRZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|