C15H19ClN6 — CID 111070192
4-(4-chlorophenyl)-N'-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111070192) has the molecular formula C15H19ClN6 and a molecular weight of 318.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111070192 |
| Molecular Formula | C15H19ClN6 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccn[nH]1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H19ClN6/c16-12-1-3-14(4-2-12)21-7-9-22(10-8-21)15(17)18-11-13-5-6-19-20-13/h1-6H,7-11H2,(H2,17,18)(H,19,20) |
| InChIKey | SUFTZZWVWHRABR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|