C20H20ClFN6O — CID 111814916
N'-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide (PubChem CID 111814916) has the molecular formula C20H20ClFN6O and a molecular weight of 414.87 g/mol. Its IUPAC name is N'-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111814916 |
| Molecular Formula | C20H20ClFN6O |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N'-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1nc(-c2ccc(Cl)cc2)no1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H20ClFN6O/c21-15-3-1-14(2-4-15)19-25-18(29-26-19)13-24-20(23)28-11-9-27(10-12-28)17-7-5-16(22)6-8-17/h1-8H,9-13H2,(H2,23,24) |
| InChIKey | XCGDCCFZWRICPZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|